C23H31Cl2N3O4 — CID 3042777
2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-phenylacetyl)amino]propanoic acid (PubChem CID 3042777) has the molecular formula C23H31Cl2N3O4 and a molecular weight of 484.42 g/mol. Its IUPAC name is 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-phenylacetyl)amino]propanoic acid.
| Compound Name | 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-phenylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 3042777 |
| Molecular Formula | C23H31Cl2N3O4 |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-phenylacetyl)amino]propanoic acid |
| SMILES | NCCO.O=C(Cc1ccccc1)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C21H24Cl2N2O3.C2H7NO/c22-10-12-25(13-11-23)18-8-6-17(7-9-18)14-19(21(27)28)24-20(26)15-16-4-2-1-3-5-16;3-1-2-4/h1-9,19H,10-15H2,(H,24,26)(H,27,28);4H,1-3H2/t19-;/m0./s1 |
| InChIKey | DUPKCGBQZREQJR-FYZYNONXSA-N |
| XLogP | 2.26 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|