C24H31Cl2N3O3 — CID 10412877
ethyl (2S)-2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-3-phenylpropanoate (PubChem CID 10412877) has the molecular formula C24H31Cl2N3O3 and a molecular weight of 480.44 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10412877 |
| Molecular Formula | C24H31Cl2N3O3 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C24H31Cl2N3O3/c1-2-32-24(31)22(17-18-6-4-3-5-7-18)28-23(30)21(27)16-19-8-10-20(11-9-19)29(14-12-25)15-13-26/h3-11,21-22H,2,12-17,27H2,1H3,(H,28,30)/t21-,22-/m0/s1 |
| InChIKey | YFWQVDHODRVPFE-VXKWHMMOSA-N |
| XLogP | 3.13 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|