C22H34Cl2N4O4 — CID 24832845
ethyl (2S)-2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate (PubChem CID 24832845) has the molecular formula C22H34Cl2N4O4 and a molecular weight of 489.44 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 24832845 |
| Molecular Formula | C22H34Cl2N4O4 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | ethyl (2S)-2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)CNC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C22H34Cl2N4O4/c1-4-32-22(31)18(27-19(29)14-26-21(30)20(25)15(2)3)13-16-5-7-17(8-6-16)28(11-9-23)12-10-24/h5-8,15,18,20H,4,9-14,25H2,1-3H3,(H,26,30)(H,27,29)/t18-,20-/m0/s1 |
| InChIKey | BOLYHVDBWILWSK-ICSRJNTNSA-N |
| XLogP | 1.66 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|