C26H35Cl3N4O4 — CID 21144855
ethyl 2-[[2-acetamido-3-(4-aminophenyl)propanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride (PubChem CID 21144855) has the molecular formula C26H35Cl3N4O4 and a molecular weight of 573.95 g/mol. Its IUPAC name is ethyl 2-[[2-acetamido-3-(4-aminophenyl)propanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride.
| Compound Name | ethyl 2-[[2-acetamido-3-(4-aminophenyl)propanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 21144855 |
| Molecular Formula | C26H35Cl3N4O4 |
| Molecular Weight | 573.95 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | ethyl 2-[[2-acetamido-3-(4-aminophenyl)propanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride |
| SMILES | CCOC(=O)C(Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)C(Cc1ccc(N)cc1)NC(C)=O.Cl |
| InChI | InChI=1S/C26H34Cl2N4O4.ClH/c1-3-36-26(35)24(17-20-6-10-22(11-7-20)32(14-12-27)15-13-28)31-25(34)23(30-18(2)33)16-19-4-8-21(29)9-5-19;/h4-11,23-24H,3,12-17,29H2,1-2H3,(H,30,33)(H,31,34);1H |
| InChIKey | XFTGTRCRRKWQET-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.95 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|