C21H34BrCl2N3O3 — CID 24764498
2-(diethylamino)ethyl (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrobromide (PubChem CID 24764498) has the molecular formula C21H34BrCl2N3O3 and a molecular weight of 527.33 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrobromide.
| Compound Name | 2-(diethylamino)ethyl (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrobromide |
|---|---|
| PubChem CID | 24764498 |
| Molecular Formula | C21H34BrCl2N3O3 |
| Molecular Weight | 527.33 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 2-(diethylamino)ethyl (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrobromide |
| SMILES | Br.CCN(CC)CCOC(=O)[C@H](Cc1ccc(N(CCCl)CCCl)cc1)NC(C)=O |
| InChI | InChI=1S/C21H33Cl2N3O3.BrH/c1-4-25(5-2)14-15-29-21(28)20(24-17(3)27)16-18-6-8-19(9-7-18)26(12-10-22)13-11-23;/h6-9,20H,4-5,10-16H2,1-3H3,(H,24,27);1H/t20-;/m0./s1 |
| InChIKey | ZNQZBAMKFJJPBB-BDQAORGHSA-N |
| XLogP | 3.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|