C17H26BrCl2N3O3 — CID 3052146
ethyl (2S)-2-[(2-aminoacetyl)amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrobromide (PubChem CID 3052146) has the molecular formula C17H26BrCl2N3O3 and a molecular weight of 471.22 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-aminoacetyl)amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrobromide.
| Compound Name | ethyl (2S)-2-[(2-aminoacetyl)amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrobromide |
|---|---|
| PubChem CID | 3052146 |
| Molecular Formula | C17H26BrCl2N3O3 |
| Molecular Weight | 471.22 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | ethyl (2S)-2-[(2-aminoacetyl)amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrobromide |
| SMILES | Br.CCOC(=O)[C@H](Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)CN |
| InChI | InChI=1S/C17H25Cl2N3O3.BrH/c1-2-25-17(24)15(21-16(23)12-20)11-13-3-5-14(6-4-13)22(9-7-18)10-8-19;/h3-6,15H,2,7-12,20H2,1H3,(H,21,23);1H/t15-;/m0./s1 |
| InChIKey | KWGIAZAFGJWHNW-RSAXXLAASA-N |
| XLogP | 2.10 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|