C28H36Cl2N2O5 — CID 10076270
methyl 3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]propanoate (PubChem CID 10076270) has the molecular formula C28H36Cl2N2O5 and a molecular weight of 551.51 g/mol. Its IUPAC name is methyl 3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]propanoate.
| Compound Name | methyl 3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 10076270 |
| Molecular Formula | C28H36Cl2N2O5 |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | methyl 3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[[3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)CC(C)(C)C1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C28H36Cl2N2O5/c1-17-18(2)26(35)24(19(3)25(17)34)28(4,5)16-23(33)31-22(27(36)37-6)15-20-7-9-21(10-8-20)32(13-11-29)14-12-30/h7-10,22H,11-16H2,1-6H3,(H,31,33) |
| InChIKey | CZOPCOWHIPSLNH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|