C23H36Cl2N4O4 — CID 10255521
ethyl 2-[[(2R)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]acetate (PubChem CID 10255521) has the molecular formula C23H36Cl2N4O4 and a molecular weight of 503.47 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]acetate.
| Compound Name | ethyl 2-[[(2R)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 10255521 |
| Molecular Formula | C23H36Cl2N4O4 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | ethyl 2-[[(2R)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C23H36Cl2N4O4/c1-4-16(3)21(26)23(32)28-19(22(31)27-15-20(30)33-5-2)14-17-6-8-18(9-7-17)29(12-10-24)13-11-25/h6-9,16,19,21H,4-5,10-15,26H2,1-3H3,(H,27,31)(H,28,32)/t16-,19+,21-/m0/s1 |
| InChIKey | XTQUKRQTVBBGNY-SCWSEQNSSA-N |
| XLogP | 2.05 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|