C17H22Cl2F3NO2 — CID 102330962
ethyl 3-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-4,4,4-trifluorobutanoate (PubChem CID 102330962) has the molecular formula C17H22Cl2F3NO2 and a molecular weight of 400.27 g/mol. Its IUPAC name is ethyl 3-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-4,4,4-trifluorobutanoate.
| Compound Name | ethyl 3-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 102330962 |
| Molecular Formula | C17H22Cl2F3NO2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | ethyl 3-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)CC(Cc1ccc(N(CCCl)CCCl)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H22Cl2F3NO2/c1-2-25-16(24)12-14(17(20,21)22)11-13-3-5-15(6-4-13)23(9-7-18)10-8-19/h3-6,14H,2,7-12H2,1H3 |
| InChIKey | FKRKKAIWLQKCAT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|