C15H18Cl2F3NO2 — CID 102330963
3-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-4,4,4-trifluorobutanoic acid (PubChem CID 102330963) has the molecular formula C15H18Cl2F3NO2 and a molecular weight of 372.21 g/mol. Its IUPAC name is 3-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-4,4,4-trifluorobutanoic acid.
| Compound Name | 3-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 102330963 |
| Molecular Formula | C15H18Cl2F3NO2 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)CC(Cc1ccc(N(CCCl)CCCl)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H18Cl2F3NO2/c16-5-7-21(8-6-17)13-3-1-11(2-4-13)9-12(10-14(22)23)15(18,19)20/h1-4,12H,5-10H2,(H,22,23) |
| InChIKey | CMYPNTNMIIKNSV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|