About 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde
2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde (PubChem CID 131739265) has the molecular formula C13H17Cl2NO3
and a molecular weight of 306.19 g/mol. Its IUPAC name is 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde.
Molecular Properties
| Compound Name | 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde |
| PubChem CID | 131739265 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde |
| SMILES | C=O.O=C(O)Cc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C12H15Cl2NO2.CH2O/c13-5-7-15(8-6-14)11-3-1-10(2-4-11)9-12(16)17;1-2/h1-4H,5-9H2,(H,16,17);1H2 |
| InChIKey | KZNUQOVHIRGVGP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde?
The IUPAC name of 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde (CID 131739265) is 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde.
What is the SMILES notation for 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde?
The canonical SMILES for 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde is C=O.O=C(O)Cc1ccc(N(CCCl)CCCl)cc1.
What is the InChIKey of 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde?
The InChIKey is KZNUQOVHIRGVGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO2.CH2O/c13-5-7-15(8-6-14)11-3-1-10(2-4-11)9-12(16)17;1-2/h1-4H,5-9H2,(H,16,17);1H2.
What are the key properties of 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde?
2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde has a molecular weight of 306.19 g/mol, XLogP of 2.41, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[bis(2-chloroethyl)amino]phenyl]acetic acid;formaldehyde is sourced from PubChem (CID 131739265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).