C14H18BrCl2NO2 — CID 20702687
4-[4-[bis(2-chloroethyl)amino]phenyl]-2-bromobutanoic acid (PubChem CID 20702687) has the molecular formula C14H18BrCl2NO2 and a molecular weight of 383.11 g/mol. Its IUPAC name is 4-[4-[bis(2-chloroethyl)amino]phenyl]-2-bromobutanoic acid.
| Compound Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]-2-bromobutanoic acid |
|---|---|
| PubChem CID | 20702687 |
| Molecular Formula | C14H18BrCl2NO2 |
| Molecular Weight | 383.11 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]-2-bromobutanoic acid |
| SMILES | O=C(O)C(Br)CCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C14H18BrCl2NO2/c15-13(14(19)20)6-3-11-1-4-12(5-2-11)18(9-7-16)10-8-17/h1-2,4-5,13H,3,6-10H2,(H,19,20) |
| InChIKey | RGYCTJIGLJPENA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.11 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|