C17H26Cl2N2O9P2 — CID 11027877
(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(4,4-diphosphonobutanoylamino)propanoic acid (PubChem CID 11027877) has the molecular formula C17H26Cl2N2O9P2 and a molecular weight of 535.25 g/mol. Its IUPAC name is (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(4,4-diphosphonobutanoylamino)propanoic acid.
| Compound Name | (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(4,4-diphosphonobutanoylamino)propanoic acid |
|---|---|
| PubChem CID | 11027877 |
| Molecular Formula | C17H26Cl2N2O9P2 |
| Molecular Weight | 535.25 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(4,4-diphosphonobutanoylamino)propanoic acid |
| SMILES | O=C(CCC(P(=O)(O)O)P(=O)(O)O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C17H26Cl2N2O9P2/c18-7-9-21(10-8-19)13-3-1-12(2-4-13)11-14(17(23)24)20-15(22)5-6-16(31(25,26)27)32(28,29)30/h1-4,14,16H,5-11H2,(H,20,22)(H,23,24)(H2,25,26,27)(H2,28,29,30)/t14-/m0/s1 |
| InChIKey | MNHPGLSPEFWNAF-AWEZNQCLSA-N |
| XLogP | 1.54 |
| TPSA | 184.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|