C23H34ClN5O8S — CID 102418720
(2S)-2-amino-5-[[(2R)-3-[2-[4-[(2S)-2-amino-2-carboxyethyl]-N-(2-chloroethyl)anilino]ethylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 102418720) has the molecular formula C23H34ClN5O8S and a molecular weight of 576.07 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R)-3-[2-[4-[(2S)-2-amino-2-carboxyethyl]-N-(2-chloroethyl)anilino]ethylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2R)-3-[2-[4-[(2S)-2-amino-2-carboxyethyl]-N-(2-chloroethyl)anilino]ethylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 102418720 |
| Molecular Formula | C23H34ClN5O8S |
| Molecular Weight | 576.07 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-3-[2-[4-[(2S)-2-amino-2-carboxyethyl]-N-(2-chloroethyl)anilino]ethylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSCCN(CCCl)c1ccc(C[C@H](N)C(=O)O)cc1)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H34ClN5O8S/c24-7-8-29(15-3-1-14(2-4-15)11-17(26)23(36)37)9-10-38-13-18(21(33)27-12-20(31)32)28-19(30)6-5-16(25)22(34)35/h1-4,16-18H,5-13,25-26H2,(H,27,33)(H,28,30)(H,31,32)(H,34,35)(H,36,37)/t16-,17-,18-/m0/s1 |
| InChIKey | FVSFUWLXGAPZDK-BZSNNMDCSA-N |
| XLogP | -0.70 |
| TPSA | 225.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.07 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|