C22H29Cl2N3O7 — CID 54101375
(2,3,5-trihydroxypyrrol-1-yl) (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 54101375) has the molecular formula C22H29Cl2N3O7 and a molecular weight of 518.39 g/mol. Its IUPAC name is (2,3,5-trihydroxypyrrol-1-yl) (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (2,3,5-trihydroxypyrrol-1-yl) (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 54101375 |
| Molecular Formula | C22H29Cl2N3O7 |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | (2,3,5-trihydroxypyrrol-1-yl) (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)On1c(O)cc(O)c1O |
| InChI | InChI=1S/C22H29Cl2N3O7/c1-22(2,3)33-21(32)25-16(20(31)34-27-18(29)13-17(28)19(27)30)12-14-4-6-15(7-5-14)26(10-8-23)11-9-24/h4-7,13,16,28-30H,8-12H2,1-3H3,(H,25,32)/t16-/m0/s1 |
| InChIKey | NASRGJQEYGDTPQ-INIZCTEOSA-N |
| XLogP | 2.98 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|