C30H41Cl2N3O5 — CID 89319297
methyl (2S)-2-[[3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate (PubChem CID 89319297) has the molecular formula C30H41Cl2N3O5 and a molecular weight of 594.58 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[[3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 89319297 |
| Molecular Formula | C30H41Cl2N3O5 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | methyl (2S)-2-[[3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoyl]amino]-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)CC(C)(C)c1c(C)cc(C)cc1OC(=O)CCN |
| InChI | InChI=1S/C30H41Cl2N3O5/c1-20-16-21(2)28(25(17-20)40-27(37)10-13-33)30(3,4)19-26(36)34-24(29(38)39-5)18-22-6-8-23(9-7-22)35(14-11-31)15-12-32/h6-9,16-17,24H,10-15,18-19,33H2,1-5H3,(H,34,36)/t24-/m0/s1 |
| InChIKey | IALHWMYYRJHUFK-DEOSSOPVSA-N |
| XLogP | 4.41 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|