C22H33Cl2N5O3 — CID 175540903
ethyl 2-[(2-amino-3-methylbutanoyl)amino]-3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propanoate (PubChem CID 175540903) has the molecular formula C22H33Cl2N5O3 and a molecular weight of 486.44 g/mol. Its IUPAC name is ethyl 2-[(2-amino-3-methylbutanoyl)amino]-3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propanoate.
| Compound Name | ethyl 2-[(2-amino-3-methylbutanoyl)amino]-3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 175540903 |
| Molecular Formula | C22H33Cl2N5O3 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | ethyl 2-[(2-amino-3-methylbutanoyl)amino]-3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propanoate |
| SMILES | CCOC(=O)C(Cc1nc2cc(N(CCCl)CCCl)ccc2n1C)NC(=O)C(N)C(C)C |
| InChI | InChI=1S/C22H33Cl2N5O3/c1-5-32-22(31)17(27-21(30)20(25)14(2)3)13-19-26-16-12-15(6-7-18(16)28(19)4)29(10-8-23)11-9-24/h6-7,12,14,17,20H,5,8-11,13,25H2,1-4H3,(H,27,30) |
| InChIKey | RFYKSQSXMFTWIA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|