C21H31Cl2N5O3 — CID 175540913
2-[(2-amino-4-methylpentanoyl)amino]-3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propanoic acid (PubChem CID 175540913) has the molecular formula C21H31Cl2N5O3 and a molecular weight of 472.42 g/mol. Its IUPAC name is 2-[(2-amino-4-methylpentanoyl)amino]-3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propanoic acid.
| Compound Name | 2-[(2-amino-4-methylpentanoyl)amino]-3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 175540913 |
| Molecular Formula | C21H31Cl2N5O3 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-[(2-amino-4-methylpentanoyl)amino]-3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(Cc1nc2cc(N(CCCl)CCCl)ccc2n1C)C(=O)O |
| InChI | InChI=1S/C21H31Cl2N5O3/c1-13(2)10-15(24)20(29)26-17(21(30)31)12-19-25-16-11-14(4-5-18(16)27(19)3)28(8-6-22)9-7-23/h4-5,11,13,15,17H,6-10,12,24H2,1-3H3,(H,26,29)(H,30,31) |
| InChIKey | ZLNIJUFPOBBRIG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|