C18H26Cl2N4O2 — CID 175540950
(2S)-2-amino-6-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]hexanoic acid (PubChem CID 175540950) has the molecular formula C18H26Cl2N4O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is (2S)-2-amino-6-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 175540950 |
| Molecular Formula | C18H26Cl2N4O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (2S)-2-amino-6-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]hexanoic acid |
| SMILES | Cn1c(CCCC[C@H](N)C(=O)O)nc2cc(N(CCCl)CCCl)ccc21 |
| InChI | InChI=1S/C18H26Cl2N4O2/c1-23-16-7-6-13(24(10-8-19)11-9-20)12-15(16)22-17(23)5-3-2-4-14(21)18(25)26/h6-7,12,14H,2-5,8-11,21H2,1H3,(H,25,26)/t14-/m0/s1 |
| InChIKey | QYDDKCZSMQAZPT-AWEZNQCLSA-N |
| XLogP | 2.98 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|