C20H28Cl2N4O2 — CID 118314753
4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-N-(3-oxobutan-2-yl)butanamide (PubChem CID 118314753) has the molecular formula C20H28Cl2N4O2 and a molecular weight of 427.38 g/mol. Its IUPAC name is 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-N-(3-oxobutan-2-yl)butanamide.
| Compound Name | 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-N-(3-oxobutan-2-yl)butanamide |
|---|---|
| PubChem CID | 118314753 |
| Molecular Formula | C20H28Cl2N4O2 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-N-(3-oxobutan-2-yl)butanamide |
| SMILES | CC(=O)C(C)NC(=O)CCCc1nc2cc(N(CCCl)CCCl)ccc2n1C |
| InChI | InChI=1S/C20H28Cl2N4O2/c1-14(15(2)27)23-20(28)6-4-5-19-24-17-13-16(7-8-18(17)25(19)3)26(11-9-21)12-10-22/h7-8,13-14H,4-6,9-12H2,1-3H3,(H,23,28) |
| InChIKey | PCRYTSCXHPHDAH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|