C19H28Cl2N4O — CID 118075243
7-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]heptanamide (PubChem CID 118075243) has the molecular formula C19H28Cl2N4O and a molecular weight of 399.37 g/mol. Its IUPAC name is 7-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]heptanamide.
| Compound Name | 7-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]heptanamide |
|---|---|
| PubChem CID | 118075243 |
| Molecular Formula | C19H28Cl2N4O |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 7-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]heptanamide |
| SMILES | Cn1c(CCCCCCC(N)=O)nc2cc(N(CCCl)CCCl)ccc21 |
| InChI | InChI=1S/C19H28Cl2N4O/c1-24-17-9-8-15(25(12-10-20)13-11-21)14-16(17)23-19(24)7-5-3-2-4-6-18(22)26/h8-9,14H,2-7,10-13H2,1H3,(H2,22,26) |
| InChIKey | BPQCRMRJCFLHTB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|