C16H21Cl2N3O2 — CID 25235228
4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid (PubChem CID 25235228) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 364.31 g/mol. Its IUPAC name is 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid.
| Compound Name | 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid |
|---|---|
| PubChem CID | 25235228 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])c1nc2cc(N(CCCl)CCCl)ccc2n1C |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-20-14-6-5-12(21(9-7-17)10-8-18)11-13(14)19-15(20)3-2-4-16(22)23/h5-6,11H,2-4,7-10H2,1H3,(H,22,23)/i2D2,3D2,4D2 |
| InChIKey | YTKUWDBFDASYHO-PWDWWLAZSA-N |
| XLogP | 3.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|