C16H22Cl2N4O2 — CID 166530191
(2S)-2-amino-4-[5-[bis(2-chloro-1,1,2,2-tetradeuterioethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid (PubChem CID 166530191) has the molecular formula C16H22Cl2N4O2 and a molecular weight of 381.33 g/mol. Its IUPAC name is (2S)-2-amino-4-[5-[bis(2-chloro-1,1,2,2-tetradeuterioethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[5-[bis(2-chloro-1,1,2,2-tetradeuterioethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 166530191 |
| Molecular Formula | C16H22Cl2N4O2 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (2S)-2-amino-4-[5-[bis(2-chloro-1,1,2,2-tetradeuterioethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid |
| SMILES | [2H]C([2H])(Cl)C([2H])([2H])N(c1ccc2c(c1)nc(CC[C@H](N)C(=O)O)n2C)C([2H])([2H])C([2H])([2H])Cl |
| InChI | InChI=1S/C16H22Cl2N4O2/c1-21-14-4-2-11(22(8-6-17)9-7-18)10-13(14)20-15(21)5-3-12(19)16(23)24/h2,4,10,12H,3,5-9,19H2,1H3,(H,23,24)/t12-/m0/s1/i6D2,7D2,8D2,9D2 |
| InChIKey | VKJXWUJEFIQCNF-UGTAFXKHSA-N |
| XLogP | 2.20 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|