C16H22Cl2N4O — CID 144625916
4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanamide (PubChem CID 144625916) has the molecular formula C16H22Cl2N4O and a molecular weight of 357.29 g/mol. Its IUPAC name is 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanamide.
| Compound Name | 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanamide |
|---|---|
| PubChem CID | 144625916 |
| Molecular Formula | C16H22Cl2N4O |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanamide |
| SMILES | Cn1c(CCCC(N)=O)nc2cc(N(CCCl)CCCl)ccc21 |
| InChI | InChI=1S/C16H22Cl2N4O/c1-21-14-6-5-12(22(9-7-17)10-8-18)11-13(14)20-16(21)4-2-3-15(19)23/h5-6,11H,2-4,7-10H2,1H3,(H2,19,23) |
| InChIKey | RNHJVFHUOMKFDL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|