C20H28Cl2N4O5 — CID 141379485
4-nitrooxybutyl 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate (PubChem CID 141379485) has the molecular formula C20H28Cl2N4O5 and a molecular weight of 475.37 g/mol. Its IUPAC name is 4-nitrooxybutyl 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate.
| Compound Name | 4-nitrooxybutyl 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate |
|---|---|
| PubChem CID | 141379485 |
| Molecular Formula | C20H28Cl2N4O5 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 4-nitrooxybutyl 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate |
| SMILES | Cn1c(CCCC(=O)OCCCCO[N+](=O)[O-])nc2cc(N(CCCl)CCCl)ccc21 |
| InChI | InChI=1S/C20H28Cl2N4O5/c1-24-18-8-7-16(25(11-9-21)12-10-22)15-17(18)23-19(24)5-4-6-20(27)30-13-2-3-14-31-26(28)29/h7-8,15H,2-6,9-14H2,1H3 |
| InChIKey | KJUVJSNWLIBLIU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|