C16H20Cl2LiN3O2 — CID 71543132
lithium 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate (PubChem CID 71543132) has the molecular formula C16H20Cl2LiN3O2 and a molecular weight of 364.20 g/mol. Its IUPAC name is lithium 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate.
| Compound Name | lithium 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate |
|---|---|
| PubChem CID | 71543132 |
| Molecular Formula | C16H20Cl2LiN3O2 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | lithium 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate |
| SMILES | Cn1c(CCCC(=O)[O-])nc2cc(N(CCCl)CCCl)ccc21.[Li+] |
| InChI | InChI=1S/C16H21Cl2N3O2.Li/c1-20-14-6-5-12(21(9-7-17)10-8-18)11-13(14)19-15(20)3-2-4-16(22)23;/h5-6,11H,2-4,7-10H2,1H3,(H,22,23);/q;+1/p-1 |
| InChIKey | IVFBTIPRGHZLHS-UHFFFAOYSA-M |
| XLogP | -1.07 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|