C25H29Cl2N3O — CID 158970964
(E)-4-[4-[3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propyl]phenyl]but-3-en-2-one (PubChem CID 158970964) has the molecular formula C25H29Cl2N3O and a molecular weight of 458.43 g/mol. Its IUPAC name is (E)-4-[4-[3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[4-[3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158970964 |
| Molecular Formula | C25H29Cl2N3O |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (E)-4-[4-[3-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]propyl]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc(CCCc2nc3cc(N(CCCl)CCCl)ccc3n2C)cc1 |
| InChI | InChI=1S/C25H29Cl2N3O/c1-19(31)6-7-21-10-8-20(9-11-21)4-3-5-25-28-23-18-22(12-13-24(23)29(25)2)30(16-14-26)17-15-27/h6-13,18H,3-5,14-17H2,1-2H3/b7-6+ |
| InChIKey | JRTLLSPFDPMXNS-VOTSOKGWSA-N |
| XLogP | 5.63 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|