C16H21Cl2N3O2 — CID 25207801
deuterio 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate (PubChem CID 25207801) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 359.28 g/mol. Its IUPAC name is deuterio 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate.
| Compound Name | deuterio 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate |
|---|---|
| PubChem CID | 25207801 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | deuterio 4-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate |
| SMILES | [2H]OC(=O)CCCc1nc2cc(N(CCCl)CCCl)ccc2n1C |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-20-14-6-5-12(21(9-7-17)10-8-18)11-13(14)19-15(20)3-2-4-16(22)23/h5-6,11H,2-4,7-10H2,1H3,(H,22,23)/i/hD |
| InChIKey | YTKUWDBFDASYHO-DYCDLGHISA-N |
| XLogP | 3.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|