C16H22Cl2N4O2 — CID 118182473
amino 4-[6-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate (PubChem CID 118182473) has the molecular formula C16H22Cl2N4O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is amino 4-[6-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate.
| Compound Name | amino 4-[6-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate |
|---|---|
| PubChem CID | 118182473 |
| Molecular Formula | C16H22Cl2N4O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | amino 4-[6-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoate |
| SMILES | Cn1c(CCCC(=O)ON)nc2ccc(N(CCCl)CCCl)cc21 |
| InChI | InChI=1S/C16H22Cl2N4O2/c1-21-14-11-12(22(9-7-17)10-8-18)5-6-13(14)20-15(21)3-2-4-16(23)24-19/h5-6,11H,2-4,7-10,19H2,1H3 |
| InChIKey | YGASYTYSPXEXMN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|