C21H29ClN4O5S — CID 118753444
4-[6-[2-(2-acetamido-2-carboxyethyl)sulfanylethyl-(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid (PubChem CID 118753444) has the molecular formula C21H29ClN4O5S and a molecular weight of 485.01 g/mol. Its IUPAC name is 4-[6-[2-(2-acetamido-2-carboxyethyl)sulfanylethyl-(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid.
| Compound Name | 4-[6-[2-(2-acetamido-2-carboxyethyl)sulfanylethyl-(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 118753444 |
| Molecular Formula | C21H29ClN4O5S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 4-[6-[2-(2-acetamido-2-carboxyethyl)sulfanylethyl-(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid |
| SMILES | CC(=O)NC(CSCCN(CCCl)c1ccc2nc(CCCC(=O)O)n(C)c2c1)C(=O)O |
| InChI | InChI=1S/C21H29ClN4O5S/c1-14(27)23-17(21(30)31)13-32-11-10-26(9-8-22)15-6-7-16-18(12-15)25(2)19(24-16)4-3-5-20(28)29/h6-7,12,17H,3-5,8-11,13H2,1-2H3,(H,23,27)(H,28,29)(H,30,31) |
| InChIKey | ANGZWXXLKYSWHP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|