C16H24ClN3O4 — CID 165428987
4-[6-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid;hydrochloride (PubChem CID 165428987) has the molecular formula C16H24ClN3O4 and a molecular weight of 357.84 g/mol. Its IUPAC name is 4-[6-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid;hydrochloride.
| Compound Name | 4-[6-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 165428987 |
| Molecular Formula | C16H24ClN3O4 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-[6-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid;hydrochloride |
| SMILES | Cl.Cn1c(CCCC(=O)O)nc2ccc(N(CCO)CCO)cc21 |
| InChI | InChI=1S/C16H23N3O4.ClH/c1-18-14-11-12(19(7-9-20)8-10-21)5-6-13(14)17-15(18)3-2-4-16(22)23;/h5-6,11,20-21H,2-4,7-10H2,1H3,(H,22,23);1H |
| InChIKey | KEQGUOGXQOWHPZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |