C16H23N3O5 — CID 118753494
4-[6-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]-4-hydroxybutanoic acid (PubChem CID 118753494) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[6-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]-4-hydroxybutanoic acid.
| Compound Name | 4-[6-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 118753494 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-[6-[bis(2-hydroxyethyl)amino]-1-methylbenzimidazol-2-yl]-4-hydroxybutanoic acid |
| SMILES | Cn1c(C(O)CCC(=O)O)nc2ccc(N(CCO)CCO)cc21 |
| InChI | InChI=1S/C16H23N3O5/c1-18-13-10-11(19(6-8-20)7-9-21)2-3-12(13)17-16(18)14(22)4-5-15(23)24/h2-3,10,14,20-22H,4-9H2,1H3,(H,23,24) |
| InChIKey | KPITXRQTULSFGL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |