C26H37N5O8S2 — CID 75212896
4-[5-[bis[2-(2-acetamido-2-carboxyethyl)sulfanylethyl]amino]-1-methylbenzimidazol-2-yl]butanoic acid (PubChem CID 75212896) has the molecular formula C26H37N5O8S2 and a molecular weight of 611.74 g/mol. Its IUPAC name is 4-[5-[bis[2-(2-acetamido-2-carboxyethyl)sulfanylethyl]amino]-1-methylbenzimidazol-2-yl]butanoic acid.
| Compound Name | 4-[5-[bis[2-(2-acetamido-2-carboxyethyl)sulfanylethyl]amino]-1-methylbenzimidazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 75212896 |
| Molecular Formula | C26H37N5O8S2 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 4-[5-[bis[2-(2-acetamido-2-carboxyethyl)sulfanylethyl]amino]-1-methylbenzimidazol-2-yl]butanoic acid |
| SMILES | CC(=O)NC(CSCCN(CCSCC(NC(C)=O)C(=O)O)c1ccc2c(c1)nc(CCCC(=O)O)n2C)C(=O)O |
| InChI | InChI=1S/C26H37N5O8S2/c1-16(32)27-20(25(36)37)14-40-11-9-31(10-12-41-15-21(26(38)39)28-17(2)33)18-7-8-22-19(13-18)29-23(30(22)3)5-4-6-24(34)35/h7-8,13,20-21H,4-6,9-12,14-15H2,1-3H3,(H,27,32)(H,28,33)(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | YSTNDPUOARKGRL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 191.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|