C32H45BCl2N4O4 — CID 142365789
7-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]heptanamide (PubChem CID 142365789) has the molecular formula C32H45BCl2N4O4 and a molecular weight of 631.45 g/mol. Its IUPAC name is 7-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]heptanamide.
| Compound Name | 7-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]heptanamide |
|---|---|
| PubChem CID | 142365789 |
| Molecular Formula | C32H45BCl2N4O4 |
| Molecular Weight | 631.45 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | 7-[5-[bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]heptanamide |
| SMILES | Cn1c(CCCCCCC(=O)NOCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)nc2cc(N(CCCl)CCCl)ccc21 |
| InChI | InChI=1S/C32H45BCl2N4O4/c1-31(2)32(3,4)43-33(42-31)25-14-12-24(13-15-25)23-41-37-30(40)11-9-7-6-8-10-29-36-27-22-26(16-17-28(27)38(29)5)39(20-18-34)21-19-35/h12-17,22H,6-11,18-21,23H2,1-5H3,(H,37,40) |
| InChIKey | CMUUMTGYBSMDJP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|