C18H27Cl2N3O5 — CID 86600844
2-[(2-aminoacetyl)amino]acetic acid;4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid (PubChem CID 86600844) has the molecular formula C18H27Cl2N3O5 and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]acetic acid;4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid.
| Compound Name | 2-[(2-aminoacetyl)amino]acetic acid;4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 86600844 |
| Molecular Formula | C18H27Cl2N3O5 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]acetic acid;4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid |
| SMILES | NCC(=O)NCC(=O)O.O=C(O)CCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C14H19Cl2NO2.C4H8N2O3/c15-8-10-17(11-9-16)13-6-4-12(5-7-13)2-1-3-14(18)19;5-1-3(7)6-2-4(8)9/h4-7H,1-3,8-11H2,(H,18,19);1-2,5H2,(H,6,7)(H,8,9) |
| InChIKey | LTASQQIFTXUUKH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|