C22H36Cl2N4O10P2 — CID 19388908
[4-[[2-[(2-aminoacetyl)-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyl]amino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid (PubChem CID 19388908) has the molecular formula C22H36Cl2N4O10P2 and a molecular weight of 649.40 g/mol. Its IUPAC name is [4-[[2-[(2-aminoacetyl)-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyl]amino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[[2-[(2-aminoacetyl)-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyl]amino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 19388908 |
| Molecular Formula | C22H36Cl2N4O10P2 |
| Molecular Weight | 649.40 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | [4-[[2-[(2-aminoacetyl)-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyl]amino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
| SMILES | NCC(=O)N(CC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)C(=O)CCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C22H36Cl2N4O10P2/c23-10-13-27(14-11-24)18-7-5-17(6-8-18)3-1-4-20(30)28(21(31)15-25)16-19(29)26-12-2-9-22(32,39(33,34)35)40(36,37)38/h5-8,32H,1-4,9-16,25H2,(H,26,29)(H2,33,34,35)(H2,36,37,38) |
| InChIKey | JXROFIOBEZGOHJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 231.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|