C22H37Cl2N5O10P2 — CID 22855871
[4-[[2-[[(2S)-2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]propanoyl]amino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid (PubChem CID 22855871) has the molecular formula C22H37Cl2N5O10P2 and a molecular weight of 664.42 g/mol. Its IUPAC name is [4-[[2-[[(2S)-2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]propanoyl]amino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[[2-[[(2S)-2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]propanoyl]amino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 22855871 |
| Molecular Formula | C22H37Cl2N5O10P2 |
| Molecular Weight | 664.42 g/mol |
| Exact Mass | 663.14 |
| IUPAC Name | [4-[[2-[[(2S)-2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]propanoyl]amino]acetyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccc(N(CCCl)CCCl)cc1)C(=O)NCC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C22H37Cl2N5O10P2/c1-15(20(31)27-14-19(30)26-10-2-7-22(33,40(34,35)36)41(37,38)39)28-21(32)18(25)13-16-3-5-17(6-4-16)29(11-8-23)12-9-24/h3-6,15,18,33H,2,7-14,25H2,1H3,(H,26,30)(H,27,31)(H,28,32)(H2,34,35,36)(H2,37,38,39)/t15-,18-/m0/s1 |
| InChIKey | INFMUEPHZJOZOX-YJBOKZPZSA-N |
| XLogP | -0.64 |
| TPSA | 251.85 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.42 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|