C19H32Cl2N2O8P2 — CID 57305574
[5-amino-9-[4-[bis(2-chloroethyl)amino]phenyl]-1-hydroxy-6-oxo-1-phosphonononyl]phosphonic acid (PubChem CID 57305574) has the molecular formula C19H32Cl2N2O8P2 and a molecular weight of 549.33 g/mol. Its IUPAC name is [5-amino-9-[4-[bis(2-chloroethyl)amino]phenyl]-1-hydroxy-6-oxo-1-phosphonononyl]phosphonic acid.
| Compound Name | [5-amino-9-[4-[bis(2-chloroethyl)amino]phenyl]-1-hydroxy-6-oxo-1-phosphonononyl]phosphonic acid |
|---|---|
| PubChem CID | 57305574 |
| Molecular Formula | C19H32Cl2N2O8P2 |
| Molecular Weight | 549.33 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | [5-amino-9-[4-[bis(2-chloroethyl)amino]phenyl]-1-hydroxy-6-oxo-1-phosphonononyl]phosphonic acid |
| SMILES | NC(CCCC(O)(P(=O)(O)O)P(=O)(O)O)C(=O)CCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C19H32Cl2N2O8P2/c20-11-13-23(14-12-21)16-8-6-15(7-9-16)3-1-5-18(24)17(22)4-2-10-19(25,32(26,27)28)33(29,30)31/h6-9,17,25H,1-5,10-14,22H2,(H2,26,27,28)(H2,29,30,31) |
| InChIKey | ZWASGZFIQVJJAV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|