C23H37Cl2N3O10P2 — CID 22855891
[3-[1-[2-[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]oxyacetyl]piperidin-4-yl]-1-hydroxy-1-phosphonopropyl]phosphonic acid (PubChem CID 22855891) has the molecular formula C23H37Cl2N3O10P2 and a molecular weight of 648.41 g/mol. Its IUPAC name is [3-[1-[2-[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]oxyacetyl]piperidin-4-yl]-1-hydroxy-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[1-[2-[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]oxyacetyl]piperidin-4-yl]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 22855891 |
| Molecular Formula | C23H37Cl2N3O10P2 |
| Molecular Weight | 648.41 g/mol |
| Exact Mass | 647.13 |
| IUPAC Name | [3-[1-[2-[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]oxyacetyl]piperidin-4-yl]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
| SMILES | N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)OCC(=O)N1CCC(CCC(O)(P(=O)(O)O)P(=O)(O)O)CC1 |
| InChI | InChI=1S/C23H37Cl2N3O10P2/c24-9-13-27(14-10-25)19-3-1-18(2-4-19)15-20(26)22(30)38-16-21(29)28-11-6-17(7-12-28)5-8-23(31,39(32,33)34)40(35,36)37/h1-4,17,20,31H,5-16,26H2,(H2,32,33,34)(H2,35,36,37)/t20-/m0/s1 |
| InChIKey | FZTZOWBMHJJIKE-FQEVSTJZSA-N |
| XLogP | 1.40 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|