C25H42Cl2N4O11P2 — CID 54538219
[4-[[2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]-methylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid (PubChem CID 54538219) has the molecular formula C25H42Cl2N4O11P2 and a molecular weight of 707.48 g/mol. Its IUPAC name is [4-[[2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]-methylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[[2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]-methylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 54538219 |
| Molecular Formula | C25H42Cl2N4O11P2 |
| Molecular Weight | 707.48 g/mol |
| Exact Mass | 706.17 |
| IUPAC Name | [4-[[2-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]-methylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
| SMILES | CN(CCCC(O)(P(=O)(O)O)P(=O)(O)O)C(=O)CN(C(=O)OC(C)(C)C)C(=O)[C@@H](N)Cc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C25H42Cl2N4O11P2/c1-24(2,3)42-23(34)31(17-21(32)29(4)13-5-10-25(35,43(36,37)38)44(39,40)41)22(33)20(28)16-18-6-8-19(9-7-18)30(14-11-26)15-12-27/h6-9,20,35H,5,10-17,28H2,1-4H3,(H2,36,37,38)(H2,39,40,41)/t20-/m0/s1 |
| InChIKey | ZBGYEYZJIWIKCJ-FQEVSTJZSA-N |
| XLogP | 1.84 |
| TPSA | 231.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|