C22H37Cl2N3O8P2 — CID 22851193
[3-[1-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]cyclohexyl]-1-hydroxy-1-phosphonopropyl]phosphonic acid (PubChem CID 22851193) has the molecular formula C22H37Cl2N3O8P2 and a molecular weight of 604.41 g/mol. Its IUPAC name is [3-[1-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]cyclohexyl]-1-hydroxy-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[1-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]cyclohexyl]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 22851193 |
| Molecular Formula | C22H37Cl2N3O8P2 |
| Molecular Weight | 604.41 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | [3-[1-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]cyclohexyl]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
| SMILES | N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)NC1(CCC(O)(P(=O)(O)O)P(=O)(O)O)CCCCC1 |
| InChI | InChI=1S/C22H37Cl2N3O8P2/c23-12-14-27(15-13-24)18-6-4-17(5-7-18)16-19(25)20(28)26-21(8-2-1-3-9-21)10-11-22(29,36(30,31)32)37(33,34)35/h4-7,19,29H,1-3,8-16,25H2,(H,26,28)(H2,30,31,32)(H2,33,34,35)/t19-/m0/s1 |
| InChIKey | JWLPLXCQZDJWQF-IBGZPJMESA-N |
| XLogP | 2.44 |
| TPSA | 193.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|