C29H51Cl2N3O7P2 — CID 57301127
(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]-N-[1-[3,3-bis(diethoxyphosphoryl)propyl]cyclopentyl]propanamide (PubChem CID 57301127) has the molecular formula C29H51Cl2N3O7P2 and a molecular weight of 686.60 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]-N-[1-[3,3-bis(diethoxyphosphoryl)propyl]cyclopentyl]propanamide.
| Compound Name | (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]-N-[1-[3,3-bis(diethoxyphosphoryl)propyl]cyclopentyl]propanamide |
|---|---|
| PubChem CID | 57301127 |
| Molecular Formula | C29H51Cl2N3O7P2 |
| Molecular Weight | 686.60 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]-N-[1-[3,3-bis(diethoxyphosphoryl)propyl]cyclopentyl]propanamide |
| SMILES | CCOP(=O)(OCC)C(CCC1(NC(=O)[C@@H](N)Cc2ccc(N(CCCl)CCCl)cc2)CCCC1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C29H51Cl2N3O7P2/c1-5-38-42(36,39-6-2)27(43(37,40-7-3)41-8-4)15-18-29(16-9-10-17-29)33-28(35)26(32)23-24-11-13-25(14-12-24)34(21-19-30)22-20-31/h11-14,26-27H,5-10,15-23,32H2,1-4H3,(H,33,35)/t26-/m0/s1 |
| InChIKey | OGJPPFVMAGIFPK-SANMLTNESA-N |
| XLogP | 6.91 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|