C16H22Cl2F3N3O3 — CID 10526703
[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]azanium;2,2,2-trifluoroacetate (PubChem CID 10526703) has the molecular formula C16H22Cl2F3N3O3 and a molecular weight of 432.27 g/mol. Its IUPAC name is [4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]azanium;2,2,2-trifluoroacetate.
| Compound Name | [4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10526703 |
| Molecular Formula | C16H22Cl2F3N3O3 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [4-[4-[bis(2-chloroethyl)amino]phenyl]butanoylamino]azanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]NC(=O)CCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C14H21Cl2N3O.C2HF3O2/c15-8-10-19(11-9-16)13-6-4-12(5-7-13)2-1-3-14(20)18-17;3-2(4,5)1(6)7/h4-7H,1-3,8-11,17H2,(H,18,20);(H,6,7) |
| InChIKey | JGLYMDGBKWFQBU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|