C29H36Cl2N6O3 — CID 139702627
N-[3-[bis(2-chloroethyl)amino]phenyl]-4-[[4-[4-(dimethylamino)butanoylamino]benzoyl]amino]-1-methylpyrrole-2-carboxamide (PubChem CID 139702627) has the molecular formula C29H36Cl2N6O3 and a molecular weight of 587.55 g/mol. Its IUPAC name is N-[3-[bis(2-chloroethyl)amino]phenyl]-4-[[4-[4-(dimethylamino)butanoylamino]benzoyl]amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[3-[bis(2-chloroethyl)amino]phenyl]-4-[[4-[4-(dimethylamino)butanoylamino]benzoyl]amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 139702627 |
| Molecular Formula | C29H36Cl2N6O3 |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | N-[3-[bis(2-chloroethyl)amino]phenyl]-4-[[4-[4-(dimethylamino)butanoylamino]benzoyl]amino]-1-methylpyrrole-2-carboxamide |
| SMILES | CN(C)CCCC(=O)Nc1ccc(C(=O)Nc2cc(C(=O)Nc3cccc(N(CCCl)CCCl)c3)n(C)c2)cc1 |
| InChI | InChI=1S/C29H36Cl2N6O3/c1-35(2)15-5-8-27(38)32-22-11-9-21(10-12-22)28(39)34-24-19-26(36(3)20-24)29(40)33-23-6-4-7-25(18-23)37(16-13-30)17-14-31/h4,6-7,9-12,18-20H,5,8,13-17H2,1-3H3,(H,32,38)(H,33,40)(H,34,39) |
| InChIKey | VCGKFLKOXQZYAU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|