C22H29Cl2N5O2 — CID 25018558
3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 25018558) has the molecular formula C22H29Cl2N5O2 and a molecular weight of 466.41 g/mol. Its IUPAC name is 3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 25018558 |
| Molecular Formula | C22H29Cl2N5O2 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1cccc(NC(=O)Nc2ccc(N(CCCl)CCCl)cc2)c1 |
| InChI | InChI=1S/C22H29Cl2N5O2/c1-28(2)15-12-25-21(30)17-4-3-5-19(16-17)27-22(31)26-18-6-8-20(9-7-18)29(13-10-23)14-11-24/h3-9,16H,10-15H2,1-2H3,(H,25,30)(H2,26,27,31) |
| InChIKey | CBBZBWGICKFARD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|