C37H41Cl2N7O3 — CID 91466883
9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methoxyanilino]-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide (PubChem CID 91466883) has the molecular formula C37H41Cl2N7O3 and a molecular weight of 702.69 g/mol. Its IUPAC name is 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methoxyanilino]-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide.
| Compound Name | 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methoxyanilino]-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide |
|---|---|
| PubChem CID | 91466883 |
| Molecular Formula | C37H41Cl2N7O3 |
| Molecular Weight | 702.69 g/mol |
| Exact Mass | 701.26 |
| IUPAC Name | 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methoxyanilino]-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide |
| SMILES | COc1cc(NC(=O)Nc2ccc(N(CCCl)CCCl)cc2)cc(Nc2c3cccc(C)c3nc3c(C(=O)NCCN(C)C)cccc23)c1 |
| InChI | InChI=1S/C37H41Cl2N7O3/c1-24-7-5-8-30-33(24)44-35-31(9-6-10-32(35)36(47)40-17-20-45(2)3)34(30)41-26-21-27(23-29(22-26)49-4)43-37(48)42-25-11-13-28(14-12-25)46(18-15-38)19-16-39/h5-14,21-23H,15-20H2,1-4H3,(H,40,47)(H,41,44)(H2,42,43,48) |
| InChIKey | JAAMGLFMRVDVTK-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.69 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|