C26H27N5O3 — CID 91058936
[5-[[4-[2-(dimethylamino)ethylcarbamoyl]acridin-9-yl]amino]-2-methylphenyl]carbamic acid (PubChem CID 91058936) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is [5-[[4-[2-(dimethylamino)ethylcarbamoyl]acridin-9-yl]amino]-2-methylphenyl]carbamic acid.
| Compound Name | [5-[[4-[2-(dimethylamino)ethylcarbamoyl]acridin-9-yl]amino]-2-methylphenyl]carbamic acid |
|---|---|
| PubChem CID | 91058936 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [5-[[4-[2-(dimethylamino)ethylcarbamoyl]acridin-9-yl]amino]-2-methylphenyl]carbamic acid |
| SMILES | Cc1ccc(Nc2c3ccccc3nc3c(C(=O)NCCN(C)C)cccc23)cc1NC(=O)O |
| InChI | InChI=1S/C26H27N5O3/c1-16-11-12-17(15-22(16)30-26(33)34)28-23-18-7-4-5-10-21(18)29-24-19(23)8-6-9-20(24)25(32)27-13-14-31(2)3/h4-12,15,30H,13-14H2,1-3H3,(H,27,32)(H,28,29)(H,33,34) |
| InChIKey | HUAFMFLXSWHZSX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|