C36H38Cl2N6O3 — CID 87745891
[4-[bis(2-chloroethyl)amino]phenyl] N-[3-[[4-[2-(dimethylamino)ethylcarbamoyl]acridin-9-yl]amino]-4-methylphenyl]carbamate (PubChem CID 87745891) has the molecular formula C36H38Cl2N6O3 and a molecular weight of 673.65 g/mol. Its IUPAC name is [4-[bis(2-chloroethyl)amino]phenyl] N-[3-[[4-[2-(dimethylamino)ethylcarbamoyl]acridin-9-yl]amino]-4-methylphenyl]carbamate.
| Compound Name | [4-[bis(2-chloroethyl)amino]phenyl] N-[3-[[4-[2-(dimethylamino)ethylcarbamoyl]acridin-9-yl]amino]-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 87745891 |
| Molecular Formula | C36H38Cl2N6O3 |
| Molecular Weight | 673.65 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | [4-[bis(2-chloroethyl)amino]phenyl] N-[3-[[4-[2-(dimethylamino)ethylcarbamoyl]acridin-9-yl]amino]-4-methylphenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)Oc2ccc(N(CCCl)CCCl)cc2)cc1Nc1c2ccccc2nc2c(C(=O)NCCN(C)C)cccc12 |
| InChI | InChI=1S/C36H38Cl2N6O3/c1-24-11-12-25(40-36(46)47-27-15-13-26(14-16-27)44(20-17-37)21-18-38)23-32(24)42-33-28-7-4-5-10-31(28)41-34-29(33)8-6-9-30(34)35(45)39-19-22-43(2)3/h4-16,23H,17-22H2,1-3H3,(H,39,45)(H,40,46)(H,41,42) |
| InChIKey | RQAAOCGSCWDRFD-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.65 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|