C27H27Cl2N5O2 — CID 25017561
9-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-N,5-dimethylacridine-4-carboxamide (PubChem CID 25017561) has the molecular formula C27H27Cl2N5O2 and a molecular weight of 524.45 g/mol. Its IUPAC name is 9-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-N,5-dimethylacridine-4-carboxamide.
| Compound Name | 9-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-N,5-dimethylacridine-4-carboxamide |
|---|---|
| PubChem CID | 25017561 |
| Molecular Formula | C27H27Cl2N5O2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 9-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-N,5-dimethylacridine-4-carboxamide |
| SMILES | CNC(=O)c1cccc2c(NC(=O)Nc3ccc(N(CCCl)CCCl)cc3)c3cccc(C)c3nc12 |
| InChI | InChI=1S/C27H27Cl2N5O2/c1-17-5-3-6-20-23(17)32-25-21(7-4-8-22(25)26(35)30-2)24(20)33-27(36)31-18-9-11-19(12-10-18)34(15-13-28)16-14-29/h3-12H,13-16H2,1-2H3,(H,30,35)(H2,31,32,33,36) |
| InChIKey | HWCAQABMIRAISE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|