C25H22Cl2N4O3 — CID 87746196
9-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]acridine-4-carboxylic acid (PubChem CID 87746196) has the molecular formula C25H22Cl2N4O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 9-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]acridine-4-carboxylic acid.
| Compound Name | 9-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]acridine-4-carboxylic acid |
|---|---|
| PubChem CID | 87746196 |
| Molecular Formula | C25H22Cl2N4O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 9-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]acridine-4-carboxylic acid |
| SMILES | O=C(Nc1ccc(N(CCCl)CCCl)cc1)Nc1c2ccccc2nc2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C25H22Cl2N4O3/c26-12-14-31(15-13-27)17-10-8-16(9-11-17)28-25(34)30-22-18-4-1-2-7-21(18)29-23-19(22)5-3-6-20(23)24(32)33/h1-11H,12-15H2,(H,32,33)(H2,28,29,30,34) |
| InChIKey | PZXGNJVKIXHIHC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|